C18H26N4 — CID 56706150
4-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-6-piperidin-4-ylpyrimidine (PubChem CID 56706150) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 4-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-6-piperidin-4-ylpyrimidine.
| Compound Name | 4-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-6-piperidin-4-ylpyrimidine |
|---|---|
| PubChem CID | 56706150 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 4-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-6-piperidin-4-ylpyrimidine |
| SMILES | C=CC[C@@H]1CC=C[C@@H](C)N1c1cc(C2CCNCC2)ncn1 |
| InChI | InChI=1S/C18H26N4/c1-3-5-16-7-4-6-14(2)22(16)18-12-17(20-13-21-18)15-8-10-19-11-9-15/h3-4,6,12-16,19H,1,5,7-11H2,2H3/t14-,16-/m1/s1 |
| InChIKey | HZLDZJACRSANPV-GDBMZVCRSA-N |
| XLogP | 3.04 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|