C18H17N5S2 — CID 56710891
2-[2-[(4-thiophen-3-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)methyl]pyrrol-1-yl]-1,3-thiazole (PubChem CID 56710891) has the molecular formula C18H17N5S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 2-[2-[(4-thiophen-3-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)methyl]pyrrol-1-yl]-1,3-thiazole.
| Compound Name | 2-[2-[(4-thiophen-3-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)methyl]pyrrol-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 56710891 |
| Molecular Formula | C18H17N5S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-[2-[(4-thiophen-3-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)methyl]pyrrol-1-yl]-1,3-thiazole |
| SMILES | c1cc(CN2CCc3[nH]cnc3C2c2ccsc2)n(-c2nccs2)c1 |
| InChI | InChI=1S/C18H17N5S2/c1-2-14(23(6-1)18-19-5-9-25-18)10-22-7-3-15-16(21-12-20-15)17(22)13-4-8-24-11-13/h1-2,4-6,8-9,11-12,17H,3,7,10H2,(H,20,21) |
| InChIKey | MUMDJDFRRCLMGU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |