C30H35N3O4 — CID 56724978
2-[2-[4-[4-(3,4-dimethylphenoxy)-2-hydroxybutyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 56724978) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is 2-[2-[4-[4-(3,4-dimethylphenoxy)-2-hydroxybutyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-[4-[4-(3,4-dimethylphenoxy)-2-hydroxybutyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 56724978 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 2-[2-[4-[4-(3,4-dimethylphenoxy)-2-hydroxybutyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1ccc(OCCC(O)CN2CCN(CCN3C(=O)c4cccc5cccc(c45)C3=O)CC2)cc1C |
| InChI | InChI=1S/C30H35N3O4/c1-21-9-10-25(19-22(21)2)37-18-11-24(34)20-32-14-12-31(13-15-32)16-17-33-29(35)26-7-3-5-23-6-4-8-27(28(23)26)30(33)36/h3-10,19,24,34H,11-18,20H2,1-2H3 |
| InChIKey | NBFVLPNUVVYAQF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|