C16H12N4O3S2 — CID 56727076
(E)-2-cyano-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-(1H-pyrrol-2-yl)prop-2-enamide (PubChem CID 56727076) has the molecular formula C16H12N4O3S2 and a molecular weight of 372.43 g/mol. Its IUPAC name is (E)-2-cyano-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-(1H-pyrrol-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-(1H-pyrrol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 56727076 |
| Molecular Formula | C16H12N4O3S2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | (E)-2-cyano-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-3-(1H-pyrrol-2-yl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=O)/C(C#N)=C/c3ccc[nH]3)sc2c1 |
| InChI | InChI=1S/C16H12N4O3S2/c1-25(22,23)12-4-5-13-14(8-12)24-16(19-13)20-15(21)10(9-17)7-11-3-2-6-18-11/h2-8,18H,1H3,(H,19,20,21)/b10-7+ |
| InChIKey | XTMCDOJPQQAQQP-JXMROGBWSA-N |
| XLogP | 2.57 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|