C16H17N3O5S — CID 56753047
N-[(7R,8aS)-2-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-7-yl]-1-benzofuran-2-sulfonamide (PubChem CID 56753047) has the molecular formula C16H17N3O5S and a molecular weight of 363.40 g/mol. Its IUPAC name is N-[(7R,8aS)-2-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-7-yl]-1-benzofuran-2-sulfonamide.
| Compound Name | N-[(7R,8aS)-2-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-7-yl]-1-benzofuran-2-sulfonamide |
|---|---|
| PubChem CID | 56753047 |
| Molecular Formula | C16H17N3O5S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-[(7R,8aS)-2-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-7-yl]-1-benzofuran-2-sulfonamide |
| SMILES | CN1CC(=O)N2C[C@H](NS(=O)(=O)c3cc4ccccc4o3)C[C@H]2C1=O |
| InChI | InChI=1S/C16H17N3O5S/c1-18-9-14(20)19-8-11(7-12(19)16(18)21)17-25(22,23)15-6-10-4-2-3-5-13(10)24-15/h2-6,11-12,17H,7-9H2,1H3/t11-,12+/m1/s1 |
| InChIKey | KUWYHPNENNLYDH-NEPJUHHUSA-N |
| XLogP | 0.15 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |