C11H10ClN5O4S — CID 56772914
methyl 4-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-chloro-5-nitrobenzoate (PubChem CID 56772914) has the molecular formula C11H10ClN5O4S and a molecular weight of 343.75 g/mol. Its IUPAC name is methyl 4-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-chloro-5-nitrobenzoate.
| Compound Name | methyl 4-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 56772914 |
| Molecular Formula | C11H10ClN5O4S |
| Molecular Weight | 343.75 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | methyl 4-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-chloro-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(Cl)c(Sc2nnc(C)n2N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H10ClN5O4S/c1-5-14-15-11(16(5)13)22-9-7(12)3-6(10(18)21-2)4-8(9)17(19)20/h3-4H,13H2,1-2H3 |
| InChIKey | NWFOSZKGPSIHAL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.75 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|