C13H14ClN5O4S — CID 56772929
propyl 4-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-chloro-5-nitrobenzoate (PubChem CID 56772929) has the molecular formula C13H14ClN5O4S and a molecular weight of 371.81 g/mol. Its IUPAC name is propyl 4-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-chloro-5-nitrobenzoate.
| Compound Name | propyl 4-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 56772929 |
| Molecular Formula | C13H14ClN5O4S |
| Molecular Weight | 371.81 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | propyl 4-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-chloro-5-nitrobenzoate |
| SMILES | CCCOC(=O)c1cc(Cl)c(Sc2nnc(C)n2N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H14ClN5O4S/c1-3-4-23-12(20)8-5-9(14)11(10(6-8)19(21)22)24-13-17-16-7(2)18(13)15/h5-6H,3-4,15H2,1-2H3 |
| InChIKey | VOSQFHBBUAAWLA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.81 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|