C16H16F3NO3 — CID 56792129
N-[2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]-N-methylfuran-3-carboxamide (PubChem CID 56792129) has the molecular formula C16H16F3NO3 and a molecular weight of 327.30 g/mol. Its IUPAC name is N-[2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]-N-methylfuran-3-carboxamide.
| Compound Name | N-[2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]-N-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 56792129 |
| Molecular Formula | C16H16F3NO3 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-[2-methoxy-1-[3-(trifluoromethyl)phenyl]ethyl]-N-methylfuran-3-carboxamide |
| SMILES | COCC(c1cccc(C(F)(F)F)c1)N(C)C(=O)c1ccoc1 |
| InChI | InChI=1S/C16H16F3NO3/c1-20(15(21)12-6-7-23-9-12)14(10-22-2)11-4-3-5-13(8-11)16(17,18)19/h3-9,14H,10H2,1-2H3 |
| InChIKey | XOHDGVFAEAIVOC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |