C16H21N5O2 — CID 56801825
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-(benzimidazol-1-yl)urea (PubChem CID 56801825) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-(benzimidazol-1-yl)urea.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-(benzimidazol-1-yl)urea |
|---|---|
| PubChem CID | 56801825 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-(benzimidazol-1-yl)urea |
| SMILES | O=C(NCC1CN2CCCC2CO1)Nn1cnc2ccccc21 |
| InChI | InChI=1S/C16H21N5O2/c22-16(19-21-11-18-14-5-1-2-6-15(14)21)17-8-13-9-20-7-3-4-12(20)10-23-13/h1-2,5-6,11-13H,3-4,7-10H2,(H2,17,19,22) |
| InChIKey | HOUCUNAJKYGGOY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |