C15H16FN3O2S — CID 56803026
N'-(2-fluorophenyl)-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]oxamide (PubChem CID 56803026) has the molecular formula C15H16FN3O2S and a molecular weight of 321.38 g/mol. Its IUPAC name is N'-(2-fluorophenyl)-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]oxamide.
| Compound Name | N'-(2-fluorophenyl)-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]oxamide |
|---|---|
| PubChem CID | 56803026 |
| Molecular Formula | C15H16FN3O2S |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N'-(2-fluorophenyl)-N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]oxamide |
| SMILES | CC(C)c1nc(CNC(=O)C(=O)Nc2ccccc2F)cs1 |
| InChI | InChI=1S/C15H16FN3O2S/c1-9(2)15-18-10(8-22-15)7-17-13(20)14(21)19-12-6-4-3-5-11(12)16/h3-6,8-9H,7H2,1-2H3,(H,17,20)(H,19,21) |
| InChIKey | FFPURNLFPBXEON-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|