C12H15F3O3S2 — CID 56818283
1-(2-methylsulfonylethylsulfanylmethyl)-4-(2,2,2-trifluoroethoxy)benzene (PubChem CID 56818283) has the molecular formula C12H15F3O3S2 and a molecular weight of 328.38 g/mol. Its IUPAC name is 1-(2-methylsulfonylethylsulfanylmethyl)-4-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 1-(2-methylsulfonylethylsulfanylmethyl)-4-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 56818283 |
| Molecular Formula | C12H15F3O3S2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 1-(2-methylsulfonylethylsulfanylmethyl)-4-(2,2,2-trifluoroethoxy)benzene |
| SMILES | CS(=O)(=O)CCSCc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3O3S2/c1-20(16,17)7-6-19-8-10-2-4-11(5-3-10)18-9-12(13,14)15/h2-5H,6-9H2,1H3 |
| InChIKey | KDVOUPBXFWEHHF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|