C21H24O6P2 — CID 56838044
(1E,4E)-1-(3-dimethylphosphoryloxy-2-hydroxyphenyl)-5-(3-dimethylphosphoryloxyphenyl)penta-1,4-dien-3-one (PubChem CID 56838044) has the molecular formula C21H24O6P2 and a molecular weight of 434.37 g/mol. Its IUPAC name is (1E,4E)-1-(3-dimethylphosphoryloxy-2-hydroxyphenyl)-5-(3-dimethylphosphoryloxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(3-dimethylphosphoryloxy-2-hydroxyphenyl)-5-(3-dimethylphosphoryloxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 56838044 |
| Molecular Formula | C21H24O6P2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | (1E,4E)-1-(3-dimethylphosphoryloxy-2-hydroxyphenyl)-5-(3-dimethylphosphoryloxyphenyl)penta-1,4-dien-3-one |
| SMILES | CP(C)(=O)Oc1cccc(/C=C/C(=O)/C=C/c2cccc(OP(C)(C)=O)c2O)c1 |
| InChI | InChI=1S/C21H24O6P2/c1-28(2,24)26-19-9-5-7-16(15-19)11-13-18(22)14-12-17-8-6-10-20(21(17)23)27-29(3,4)25/h5-15,23H,1-4H3/b13-11+,14-12+ |
| InChIKey | BBKONTLWYPLUFB-PHEQNACWSA-N |
| XLogP | 5.52 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|