C17H16O9P2 — CID 56838042
[3-[(1E,4E)-3-oxo-5-(3-phosphonooxyphenyl)penta-1,4-dienyl]phenyl] dihydrogen phosphate (PubChem CID 56838042) has the molecular formula C17H16O9P2 and a molecular weight of 426.25 g/mol. Its IUPAC name is [3-[(1E,4E)-3-oxo-5-(3-phosphonooxyphenyl)penta-1,4-dienyl]phenyl] dihydrogen phosphate.
| Compound Name | [3-[(1E,4E)-3-oxo-5-(3-phosphonooxyphenyl)penta-1,4-dienyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 56838042 |
| Molecular Formula | C17H16O9P2 |
| Molecular Weight | 426.25 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | [3-[(1E,4E)-3-oxo-5-(3-phosphonooxyphenyl)penta-1,4-dienyl]phenyl] dihydrogen phosphate |
| SMILES | O=C(/C=C/c1cccc(OP(=O)(O)O)c1)/C=C/c1cccc(OP(=O)(O)O)c1 |
| InChI | InChI=1S/C17H16O9P2/c18-15(9-7-13-3-1-5-16(11-13)25-27(19,20)21)10-8-14-4-2-6-17(12-14)26-28(22,23)24/h1-12H,(H2,19,20,21)(H2,22,23,24)/b9-7+,10-8+ |
| InChIKey | GJYHUDAGJFXGJD-FIFLTTCUSA-N |
| XLogP | 2.93 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|