C19H18O4S — CID 56840646
[3-[(1E,4E)-3-oxo-5-phenylpenta-1,4-dienyl]phenyl] ethanesulfonate (PubChem CID 56840646) has the molecular formula C19H18O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is [3-[(1E,4E)-3-oxo-5-phenylpenta-1,4-dienyl]phenyl] ethanesulfonate.
| Compound Name | [3-[(1E,4E)-3-oxo-5-phenylpenta-1,4-dienyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 56840646 |
| Molecular Formula | C19H18O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | [3-[(1E,4E)-3-oxo-5-phenylpenta-1,4-dienyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cccc(/C=C/C(=O)/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C19H18O4S/c1-2-24(21,22)23-19-10-6-9-17(15-19)12-14-18(20)13-11-16-7-4-3-5-8-16/h3-15H,2H2,1H3/b13-11+,14-12+ |
| InChIKey | ZSGSIUNUWOXZOY-PHEQNACWSA-N |
| XLogP | 3.71 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|