C29H22O7S2 — CID 56837398
[3-[(1E,4E)-5-[3-(benzenesulfonyloxy)phenyl]-3-oxopenta-1,4-dienyl]phenyl] benzenesulfonate (PubChem CID 56837398) has the molecular formula C29H22O7S2 and a molecular weight of 546.62 g/mol. Its IUPAC name is [3-[(1E,4E)-5-[3-(benzenesulfonyloxy)phenyl]-3-oxopenta-1,4-dienyl]phenyl] benzenesulfonate.
| Compound Name | [3-[(1E,4E)-5-[3-(benzenesulfonyloxy)phenyl]-3-oxopenta-1,4-dienyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 56837398 |
| Molecular Formula | C29H22O7S2 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | [3-[(1E,4E)-5-[3-(benzenesulfonyloxy)phenyl]-3-oxopenta-1,4-dienyl]phenyl] benzenesulfonate |
| SMILES | O=C(/C=C/c1cccc(OS(=O)(=O)c2ccccc2)c1)/C=C/c1cccc(OS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C29H22O7S2/c30-25(19-17-23-9-7-11-26(21-23)35-37(31,32)28-13-3-1-4-14-28)20-18-24-10-8-12-27(22-24)36-38(33,34)29-15-5-2-6-16-29/h1-22H/b19-17+,20-18+ |
| InChIKey | TUMUGSRLRMVFPQ-XPWSMXQVSA-N |
| XLogP | 5.52 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|