C18H13NNa2O7S — CID 56842894
disodium;2-[4-[(5-hydroxy-7-sulfonatonaphthalen-2-yl)amino]phenoxy]acetate (PubChem CID 56842894) has the molecular formula C18H13NNa2O7S and a molecular weight of 433.35 g/mol. Its IUPAC name is disodium;2-[4-[(5-hydroxy-7-sulfonatonaphthalen-2-yl)amino]phenoxy]acetate.
| Compound Name | disodium;2-[4-[(5-hydroxy-7-sulfonatonaphthalen-2-yl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 56842894 |
| Molecular Formula | C18H13NNa2O7S |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | disodium;2-[4-[(5-hydroxy-7-sulfonatonaphthalen-2-yl)amino]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccc(Nc2ccc3c(O)cc(S(=O)(=O)[O-])cc3c2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C18H15NO7S.2Na/c20-17-9-15(27(23,24)25)8-11-7-13(3-6-16(11)17)19-12-1-4-14(5-2-12)26-10-18(21)22;;/h1-9,19-20H,10H2,(H,21,22)(H,23,24,25);;/q;2*+1/p-2 |
| InChIKey | XHNFPIXZIJIJCL-UHFFFAOYSA-L |
| XLogP | -4.67 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | -4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|