About [4-methyl-2-[4-methyl-5-(propanoyloxymethyl)-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]methyl propanoate
[4-methyl-2-[4-methyl-5-(propanoyloxymethyl)-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]methyl propanoate (PubChem CID 56850318) has the molecular formula C16H20N2O4S2
and a molecular weight of 368.48 g/mol. Its IUPAC name is [4-methyl-2-[4-methyl-5-(propanoyloxymethyl)-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]methyl propanoate.
Molecular Properties
| Compound Name | [4-methyl-2-[4-methyl-5-(propanoyloxymethyl)-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]methyl propanoate |
| PubChem CID | 56850318 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [4-methyl-2-[4-methyl-5-(propanoyloxymethyl)-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]methyl propanoate |
| SMILES | CCC(=O)OCc1sc(-c2nc(C)c(COC(=O)CC)s2)nc1C |
| InChI | InChI=1S/C16H20N2O4S2/c1-5-13(19)21-7-11-9(3)17-15(23-11)16-18-10(4)12(24-16)8-22-14(20)6-2/h5-8H2,1-4H3 |
| InChIKey | LQSGCIYCRLRNLC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [4-methyl-2-[4-methyl-5-(propanoyloxymethyl)-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]methyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-2-[4-methyl-5-(propanoyloxymethyl)-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]methyl propanoate?
The IUPAC name of [4-methyl-2-[4-methyl-5-(propanoyloxymethyl)-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]methyl propanoate (CID 56850318) is [4-methyl-2-[4-methyl-5-(propanoyloxymethyl)-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]methyl propanoate.
What is the SMILES notation for [4-methyl-2-[4-methyl-5-(propanoyloxymethyl)-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]methyl propanoate?
The canonical SMILES for [4-methyl-2-[4-methyl-5-(propanoyloxymethyl)-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]methyl propanoate is CCC(=O)OCc1sc(-c2nc(C)c(COC(=O)CC)s2)nc1C.
What is the InChIKey of [4-methyl-2-[4-methyl-5-(propanoyloxymethyl)-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]methyl propanoate?
The InChIKey is LQSGCIYCRLRNLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O4S2/c1-5-13(19)21-7-11-9(3)17-15(23-11)16-18-10(4)12(24-16)8-22-14(20)6-2/h5-8H2,1-4H3.
What are the key properties of [4-methyl-2-[4-methyl-5-(propanoyloxymethyl)-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]methyl propanoate?
[4-methyl-2-[4-methyl-5-(propanoyloxymethyl)-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]methyl propanoate has a molecular weight of 368.48 g/mol, XLogP of 3.79, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-2-[4-methyl-5-(propanoyloxymethyl)-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]methyl propanoate is sourced from PubChem (CID 56850318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).