C18H28O6 — CID 56851496
ethyl 2-[(2S,3S,6S)-6-[(E,6S)-6-acetyloxyhept-1-enyl]-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]acetate (PubChem CID 56851496) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is ethyl 2-[(2S,3S,6S)-6-[(E,6S)-6-acetyloxyhept-1-enyl]-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,3S,6S)-6-[(E,6S)-6-acetyloxyhept-1-enyl]-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]acetate |
|---|---|
| PubChem CID | 56851496 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | ethyl 2-[(2S,3S,6S)-6-[(E,6S)-6-acetyloxyhept-1-enyl]-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1O[C@@H](/C=C/CCC[C@H](C)OC(C)=O)C=C[C@@H]1O |
| InChI | InChI=1S/C18H28O6/c1-4-22-18(21)12-17-16(20)11-10-15(24-17)9-7-5-6-8-13(2)23-14(3)19/h7,9-11,13,15-17,20H,4-6,8,12H2,1-3H3/b9-7+/t13-,15-,16-,17-/m0/s1 |
| InChIKey | OEJQUYWBZDFVNO-CNDNLEPQSA-N |
| XLogP | 2.30 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|