C21H29N5S — CID 56855156
2-[3-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)piperidin-1-yl]phenyl]-5-methyl-1,3,4-thiadiazole (PubChem CID 56855156) has the molecular formula C21H29N5S and a molecular weight of 383.57 g/mol. Its IUPAC name is 2-[3-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)piperidin-1-yl]phenyl]-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-[3-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)piperidin-1-yl]phenyl]-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 56855156 |
| Molecular Formula | C21H29N5S |
| Molecular Weight | 383.57 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 2-[3-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)piperidin-1-yl]phenyl]-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(-c2cccc(N3CCC(N4CCN5CCCC5C4)CC3)c2)s1 |
| InChI | InChI=1S/C21H29N5S/c1-16-22-23-21(27-16)17-4-2-5-19(14-17)25-10-7-18(8-11-25)26-13-12-24-9-3-6-20(24)15-26/h2,4-5,14,18,20H,3,6-13,15H2,1H3 |
| InChIKey | IGECAEZGEYOGQX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |