C21H23N7OS — CID 67350095
(6S)-13-(ethylamino)-8-[3-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 67350095) has the molecular formula C21H23N7OS and a molecular weight of 421.53 g/mol. Its IUPAC name is (6S)-13-(ethylamino)-8-[3-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | (6S)-13-(ethylamino)-8-[3-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 67350095 |
| Molecular Formula | C21H23N7OS |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | (6S)-13-(ethylamino)-8-[3-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CCNc1ncc2c(n1)N1CCC[C@H]1CN(c1cccc(-c3nnc(C)s3)c1)C2=O |
| InChI | InChI=1S/C21H23N7OS/c1-3-22-21-23-11-17-18(24-21)27-9-5-8-16(27)12-28(20(17)29)15-7-4-6-14(10-15)19-26-25-13(2)30-19/h4,6-7,10-11,16H,3,5,8-9,12H2,1-2H3,(H,22,23,24)/t16-/m0/s1 |
| InChIKey | UJPNBKRYACFNRC-INIZCTEOSA-N |
| XLogP | 3.36 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |