C22H23N7O3 — CID 67352787
2-[3-[13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 67352787) has the molecular formula C22H23N7O3 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-[3-[13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]phenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[3-[13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]phenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 67352787 |
| Molecular Formula | C22H23N7O3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 2-[3-[13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCNc1ncc2c(n1)N1CCCC1CN(c1cccc(-c3nc(C(N)=O)co3)c1)C2=O |
| InChI | InChI=1S/C22H23N7O3/c1-2-24-22-25-10-16-19(27-22)28-8-4-7-15(28)11-29(21(16)31)14-6-3-5-13(9-14)20-26-17(12-32-20)18(23)30/h3,5-6,9-10,12,15H,2,4,7-8,11H2,1H3,(H2,23,30)(H,24,25,27) |
| InChIKey | YWHQZZVVPVZVSJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |