C25H35N7O — CID 67351350
(6S)-13-(ethylamino)-8-[3-(4-propan-2-ylpiperazin-1-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 67351350) has the molecular formula C25H35N7O and a molecular weight of 449.60 g/mol. Its IUPAC name is (6S)-13-(ethylamino)-8-[3-(4-propan-2-ylpiperazin-1-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | (6S)-13-(ethylamino)-8-[3-(4-propan-2-ylpiperazin-1-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 67351350 |
| Molecular Formula | C25H35N7O |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | (6S)-13-(ethylamino)-8-[3-(4-propan-2-ylpiperazin-1-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CCNc1ncc2c(n1)N1CCC[C@H]1CN(c1cccc(N3CCN(C(C)C)CC3)c1)C2=O |
| InChI | InChI=1S/C25H35N7O/c1-4-26-25-27-16-22-23(28-25)31-10-6-9-21(31)17-32(24(22)33)20-8-5-7-19(15-20)30-13-11-29(12-14-30)18(2)3/h5,7-8,15-16,18,21H,4,6,9-14,17H2,1-3H3,(H,26,27,28)/t21-/m0/s1 |
| InChIKey | TXXMLDNSGBIIGH-NRFANRHFSA-N |
| XLogP | 3.07 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |