C22H23F2N7O3 — CID 87367312
3-(2,2-difluoroethyl)-5-[3-[(6S)-13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]phenyl]-1,3,4-oxadiazol-2-one (PubChem CID 87367312) has the molecular formula C22H23F2N7O3 and a molecular weight of 471.47 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-5-[3-[(6S)-13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]phenyl]-1,3,4-oxadiazol-2-one.
| Compound Name | 3-(2,2-difluoroethyl)-5-[3-[(6S)-13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]phenyl]-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 87367312 |
| Molecular Formula | C22H23F2N7O3 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 3-(2,2-difluoroethyl)-5-[3-[(6S)-13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]phenyl]-1,3,4-oxadiazol-2-one |
| SMILES | CCNc1ncc2c(n1)N1CCC[C@H]1CN(c1cccc(-c3nn(CC(F)F)c(=O)o3)c1)C2=O |
| InChI | InChI=1S/C22H23F2N7O3/c1-2-25-21-26-10-16-18(27-21)29-8-4-7-15(29)11-30(20(16)32)14-6-3-5-13(9-14)19-28-31(12-17(23)24)22(33)34-19/h3,5-6,9-10,15,17H,2,4,7-8,11-12H2,1H3,(H,25,26,27)/t15-/m0/s1 |
| InChIKey | KHEONUVLKGZGSG-HNNXBMFYSA-N |
| XLogP | 2.62 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |