C25H33N7O2 — CID 77271503
13-(ethylamino)-8-[3-(4-propanoylpiperazin-1-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 77271503) has the molecular formula C25H33N7O2 and a molecular weight of 463.59 g/mol. Its IUPAC name is 13-(ethylamino)-8-[3-(4-propanoylpiperazin-1-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | 13-(ethylamino)-8-[3-(4-propanoylpiperazin-1-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 77271503 |
| Molecular Formula | C25H33N7O2 |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | 13-(ethylamino)-8-[3-(4-propanoylpiperazin-1-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CCNc1ncc2c(n1)N1CCCC1CN(c1cccc(N3CCN(C(=O)CC)CC3)c1)C2=O |
| InChI | InChI=1S/C25H33N7O2/c1-3-22(33)30-13-11-29(12-14-30)18-7-5-8-19(15-18)32-17-20-9-6-10-31(20)23-21(24(32)34)16-27-25(28-23)26-4-2/h5,7-8,15-16,20H,3-4,6,9-14,17H2,1-2H3,(H,26,27,28) |
| InChIKey | XSMACKFTZZOEAB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |