C17H16N4 — CID 56864814
6-(1,2,3,4-tetrahydroisoquinolin-5-yl)quinazolin-4-amine (PubChem CID 56864814) has the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. Its IUPAC name is 6-(1,2,3,4-tetrahydroisoquinolin-5-yl)quinazolin-4-amine.
| Compound Name | 6-(1,2,3,4-tetrahydroisoquinolin-5-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 56864814 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 6-(1,2,3,4-tetrahydroisoquinolin-5-yl)quinazolin-4-amine |
| SMILES | Nc1ncnc2ccc(-c3cccc4c3CCNC4)cc12 |
| InChI | InChI=1S/C17H16N4/c18-17-15-8-11(4-5-16(15)20-10-21-17)13-3-1-2-12-9-19-7-6-14(12)13/h1-5,8,10,19H,6-7,9H2,(H2,18,20,21) |
| InChIKey | BRLJJAGWTAJWFI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |