C16H19N3O3S — CID 56865483
N-[(7S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-2-(2-methylphenyl)sulfanylacetamide (PubChem CID 56865483) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is N-[(7S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-2-(2-methylphenyl)sulfanylacetamide.
| Compound Name | N-[(7S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-2-(2-methylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 56865483 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[(7S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-2-(2-methylphenyl)sulfanylacetamide |
| SMILES | Cc1ccccc1SCC(=O)N[C@H]1C[C@H]2C(=O)NCC(=O)N2C1 |
| InChI | InChI=1S/C16H19N3O3S/c1-10-4-2-3-5-13(10)23-9-14(20)18-11-6-12-16(22)17-7-15(21)19(12)8-11/h2-5,11-12H,6-9H2,1H3,(H,17,22)(H,18,20)/t11-,12-/m0/s1 |
| InChIKey | DKRJNLOQKSSQTM-RYUDHWBXSA-N |
| XLogP | 0.30 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |