C20H21N5O3 — CID 121494874
N-[(7S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-(4,6-dimethylpyrimidin-2-yl)benzamide (PubChem CID 121494874) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[(7S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-(4,6-dimethylpyrimidin-2-yl)benzamide.
| Compound Name | N-[(7S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-(4,6-dimethylpyrimidin-2-yl)benzamide |
|---|---|
| PubChem CID | 121494874 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[(7S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-(4,6-dimethylpyrimidin-2-yl)benzamide |
| SMILES | Cc1cc(C)nc(-c2ccc(C(=O)N[C@H]3C[C@H]4C(=O)NCC(=O)N4C3)cc2)n1 |
| InChI | InChI=1S/C20H21N5O3/c1-11-7-12(2)23-18(22-11)13-3-5-14(6-4-13)19(27)24-15-8-16-20(28)21-9-17(26)25(16)10-15/h3-7,15-16H,8-10H2,1-2H3,(H,21,28)(H,24,27)/t15-,16-/m0/s1 |
| InChIKey | OVUZGLXFSJIHEY-HOTGVXAUSA-N |
| XLogP | 0.59 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |