C19H28N2O4S — CID 56866623
N-[3-[(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-4,5-dimethylthiophen-2-yl]-2-methylpropanamide (PubChem CID 56866623) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-[3-[(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-4,5-dimethylthiophen-2-yl]-2-methylpropanamide.
| Compound Name | N-[3-[(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-4,5-dimethylthiophen-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 56866623 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[3-[(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-4,5-dimethylthiophen-2-yl]-2-methylpropanamide |
| SMILES | Cc1sc(NC(=O)C(C)C)c(C(=O)N2C[C@H]3C[C@H](O)[C@@H](O)C[C@H]3C2)c1C |
| InChI | InChI=1S/C19H28N2O4S/c1-9(2)17(24)20-18-16(10(3)11(4)26-18)19(25)21-7-12-5-14(22)15(23)6-13(12)8-21/h9,12-15,22-23H,5-8H2,1-4H3,(H,20,24)/t12-,13+,14-,15-/m0/s1 |
| InChIKey | YQQOBYVGRLOURV-XGUBFFRZSA-N |
| XLogP | 2.16 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |