C18H10F3N3O — CID 56876036
2-amino-4-(3-hydroxyphenyl)-6-(2,4,5-trifluorophenyl)pyridine-3-carbonitrile (PubChem CID 56876036) has the molecular formula C18H10F3N3O and a molecular weight of 341.29 g/mol. Its IUPAC name is 2-amino-4-(3-hydroxyphenyl)-6-(2,4,5-trifluorophenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(3-hydroxyphenyl)-6-(2,4,5-trifluorophenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 56876036 |
| Molecular Formula | C18H10F3N3O |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2-amino-4-(3-hydroxyphenyl)-6-(2,4,5-trifluorophenyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2cccc(O)c2)cc(-c2cc(F)c(F)cc2F)nc1N |
| InChI | InChI=1S/C18H10F3N3O/c19-14-7-16(21)15(20)5-12(14)17-6-11(13(8-22)18(23)24-17)9-2-1-3-10(25)4-9/h1-7,25H,(H2,23,24) |
| InChIKey | OVYWAPPVVCZEKX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|