C10H16N4O3S2 — CID 56880491
N-[2-(dimethylsulfamoyl)ethyl]-2-methylsulfanylpyrimidine-5-carboxamide (PubChem CID 56880491) has the molecular formula C10H16N4O3S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)ethyl]-2-methylsulfanylpyrimidine-5-carboxamide.
| Compound Name | N-[2-(dimethylsulfamoyl)ethyl]-2-methylsulfanylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 56880491 |
| Molecular Formula | C10H16N4O3S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)ethyl]-2-methylsulfanylpyrimidine-5-carboxamide |
| SMILES | CSc1ncc(C(=O)NCCS(=O)(=O)N(C)C)cn1 |
| InChI | InChI=1S/C10H16N4O3S2/c1-14(2)19(16,17)5-4-11-9(15)8-6-12-10(18-3)13-7-8/h6-7H,4-5H2,1-3H3,(H,11,15) |
| InChIKey | HSNDFWOOSWVIRB-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |