C18H21FN6O — CID 56904923
2-[1-[(2-fluorophenyl)methyl]-4-(7H-purin-6-yl)piperazin-2-yl]ethanol (PubChem CID 56904923) has the molecular formula C18H21FN6O and a molecular weight of 356.41 g/mol. Its IUPAC name is 2-[1-[(2-fluorophenyl)methyl]-4-(7H-purin-6-yl)piperazin-2-yl]ethanol.
| Compound Name | 2-[1-[(2-fluorophenyl)methyl]-4-(7H-purin-6-yl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 56904923 |
| Molecular Formula | C18H21FN6O |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 2-[1-[(2-fluorophenyl)methyl]-4-(7H-purin-6-yl)piperazin-2-yl]ethanol |
| SMILES | OCCC1CN(c2ncnc3nc[nH]c23)CCN1Cc1ccccc1F |
| InChI | InChI=1S/C18H21FN6O/c19-15-4-2-1-3-13(15)9-24-6-7-25(10-14(24)5-8-26)18-16-17(21-11-20-16)22-12-23-18/h1-4,11-12,14,26H,5-10H2,(H,20,21,22,23) |
| InChIKey | XYMLRXYJZTUFCE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |