C16H18N4O2 — CID 56908693
5-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-N-butylfuran-2-carboxamide (PubChem CID 56908693) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 5-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-N-butylfuran-2-carboxamide.
| Compound Name | 5-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-N-butylfuran-2-carboxamide |
|---|---|
| PubChem CID | 56908693 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 5-(6-amino-1H-pyrrolo[2,3-b]pyridin-4-yl)-N-butylfuran-2-carboxamide |
| SMILES | CCCCNC(=O)c1ccc(-c2cc(N)nc3[nH]ccc23)o1 |
| InChI | InChI=1S/C16H18N4O2/c1-2-3-7-19-16(21)13-5-4-12(22-13)11-9-14(17)20-15-10(11)6-8-18-15/h4-6,8-9H,2-3,7H2,1H3,(H,19,21)(H3,17,18,20) |
| InChIKey | WVTSBUIXPJUYDU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|