C16H24O8S2 — CID 569238
[3,4,5-triacetyloxy-5-(1,3-dithiolan-2-yl)pentan-2-yl] acetate (PubChem CID 569238) has the molecular formula C16H24O8S2 and a molecular weight of 408.49 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-5-(1,3-dithiolan-2-yl)pentan-2-yl] acetate.
| Compound Name | [3,4,5-triacetyloxy-5-(1,3-dithiolan-2-yl)pentan-2-yl] acetate |
|---|---|
| PubChem CID | 569238 |
| Molecular Formula | C16H24O8S2 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | [3,4,5-triacetyloxy-5-(1,3-dithiolan-2-yl)pentan-2-yl] acetate |
| SMILES | CC(=O)OC(C)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1SCCS1 |
| InChI | InChI=1S/C16H24O8S2/c1-8(21-9(2)17)13(22-10(3)18)14(23-11(4)19)15(24-12(5)20)16-25-6-7-26-16/h8,13-16H,6-7H2,1-5H3 |
| InChIKey | YJJVQBLLJIVAOW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|