C21H17BrN2O4S — CID 56926542
6-[4-(4-bromophenyl)-2-sulfanylidene-5,6-dihydro-1H-pyrimidin-6-yl]-7-hydroxy-5-methoxy-2-methylchromen-4-one (PubChem CID 56926542) has the molecular formula C21H17BrN2O4S and a molecular weight of 473.35 g/mol. Its IUPAC name is 6-[4-(4-bromophenyl)-2-sulfanylidene-5,6-dihydro-1H-pyrimidin-6-yl]-7-hydroxy-5-methoxy-2-methylchromen-4-one.
| Compound Name | 6-[4-(4-bromophenyl)-2-sulfanylidene-5,6-dihydro-1H-pyrimidin-6-yl]-7-hydroxy-5-methoxy-2-methylchromen-4-one |
|---|---|
| PubChem CID | 56926542 |
| Molecular Formula | C21H17BrN2O4S |
| Molecular Weight | 473.35 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | 6-[4-(4-bromophenyl)-2-sulfanylidene-5,6-dihydro-1H-pyrimidin-6-yl]-7-hydroxy-5-methoxy-2-methylchromen-4-one |
| SMILES | COc1c(C2CC(c3ccc(Br)cc3)=NC(=S)N2)c(O)cc2oc(C)cc(=O)c12 |
| InChI | InChI=1S/C21H17BrN2O4S/c1-10-7-15(25)19-17(28-10)9-16(26)18(20(19)27-2)14-8-13(23-21(29)24-14)11-3-5-12(22)6-4-11/h3-7,9,14,26H,8H2,1-2H3,(H,24,29) |
| InChIKey | LBRDOVJFBYZWGV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|