C11H11ClO2 — CID 56926843
3-(3-chlorophenyl)-1,2-dioxaspiro[3.3]heptane (PubChem CID 56926843) has the molecular formula C11H11ClO2 and a molecular weight of 210.66 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1,2-dioxaspiro[3.3]heptane.
| Compound Name | 3-(3-chlorophenyl)-1,2-dioxaspiro[3.3]heptane |
|---|---|
| PubChem CID | 56926843 |
| Molecular Formula | C11H11ClO2 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 3-(3-chlorophenyl)-1,2-dioxaspiro[3.3]heptane |
| SMILES | Clc1cccc(C2OOC23CCC3)c1 |
| InChI | InChI=1S/C11H11ClO2/c12-9-4-1-3-8(7-9)10-11(14-13-10)5-2-6-11/h1,3-4,7,10H,2,5-6H2 |
| InChIKey | AMJYMSFRKUQNPL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|