C11H5F8NO — CID 569308
[2,2-difluoro-3,3-bis(trifluoromethyl)aziridin-1-yl]-phenylmethanone (PubChem CID 569308) has the molecular formula C11H5F8NO and a molecular weight of 319.15 g/mol. Its IUPAC name is [2,2-difluoro-3,3-bis(trifluoromethyl)aziridin-1-yl]-phenylmethanone.
| Compound Name | [2,2-difluoro-3,3-bis(trifluoromethyl)aziridin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 569308 |
| Molecular Formula | C11H5F8NO |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | [2,2-difluoro-3,3-bis(trifluoromethyl)aziridin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1C(F)(F)C1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H5F8NO/c12-9(13,14)8(10(15,16)17)11(18,19)20(8)7(21)6-4-2-1-3-5-6/h1-5H |
| InChIKey | VFANXPTWSPJOPQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|