C15H18FNO4 — CID 11277841
methyl (4R,5R)-3-benzoyl-4-fluoro-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate (PubChem CID 11277841) has the molecular formula C15H18FNO4 and a molecular weight of 295.31 g/mol. Its IUPAC name is methyl (4R,5R)-3-benzoyl-4-fluoro-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate.
| Compound Name | methyl (4R,5R)-3-benzoyl-4-fluoro-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 11277841 |
| Molecular Formula | C15H18FNO4 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | methyl (4R,5R)-3-benzoyl-4-fluoro-2,2,5-trimethyl-1,3-oxazolidine-4-carboxylate |
| SMILES | COC(=O)[C@]1(F)[C@@H](C)OC(C)(C)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18FNO4/c1-10-15(16,13(19)20-4)17(14(2,3)21-10)12(18)11-8-6-5-7-9-11/h5-10H,1-4H3/t10-,15+/m1/s1 |
| InChIKey | LBDHGCHCHOQQJH-BMIGLBTASA-N |
| XLogP | 2.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|