C28H35NO4S — CID 56934934
4-[(2,2-dimethyl-1-phenylbut-3-enyl)-(4-methylphenyl)sulfonylamino]but-2-ynyl 2,2-dimethylpropanoate (PubChem CID 56934934) has the molecular formula C28H35NO4S and a molecular weight of 481.66 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-1-phenylbut-3-enyl)-(4-methylphenyl)sulfonylamino]but-2-ynyl 2,2-dimethylpropanoate.
| Compound Name | 4-[(2,2-dimethyl-1-phenylbut-3-enyl)-(4-methylphenyl)sulfonylamino]but-2-ynyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 56934934 |
| Molecular Formula | C28H35NO4S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 4-[(2,2-dimethyl-1-phenylbut-3-enyl)-(4-methylphenyl)sulfonylamino]but-2-ynyl 2,2-dimethylpropanoate |
| SMILES | C=CC(C)(C)C(c1ccccc1)N(CC#CCOC(=O)C(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H35NO4S/c1-8-28(6,7)25(23-14-10-9-11-15-23)29(20-12-13-21-33-26(30)27(3,4)5)34(31,32)24-18-16-22(2)17-19-24/h8-11,14-19,25H,1,20-21H2,2-7H3 |
| InChIKey | GKNKBKXQTMUNKS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|