C18H25N5O3 — CID 56945638
9-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-8-[(E)-hex-1-enyl]purin-6-amine (PubChem CID 56945638) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 9-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-8-[(E)-hex-1-enyl]purin-6-amine.
| Compound Name | 9-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-8-[(E)-hex-1-enyl]purin-6-amine |
|---|---|
| PubChem CID | 56945638 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 9-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-8-[(E)-hex-1-enyl]purin-6-amine |
| SMILES | CCCC/C=C/c1nc2c(N)ncnc2n1[C@@H]1OC[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C18H25N5O3/c1-4-5-6-7-8-12-22-13-15(19)20-10-21-16(13)23(12)17-14-11(9-24-17)25-18(2,3)26-14/h7-8,10-11,14,17H,4-6,9H2,1-3H3,(H2,19,20,21)/b8-7+/t11-,14-,17-/m1/s1 |
| InChIKey | VZDBPDUUZSSBES-RFJHDPNMSA-N |
| XLogP | 2.66 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|