C19H21FO3 — CID 56946569
(E,2R)-6-(4-fluorophenyl)-1-phenylmethoxyhex-5-ene-2,4-diol (PubChem CID 56946569) has the molecular formula C19H21FO3 and a molecular weight of 316.37 g/mol. Its IUPAC name is (E,2R)-6-(4-fluorophenyl)-1-phenylmethoxyhex-5-ene-2,4-diol.
| Compound Name | (E,2R)-6-(4-fluorophenyl)-1-phenylmethoxyhex-5-ene-2,4-diol |
|---|---|
| PubChem CID | 56946569 |
| Molecular Formula | C19H21FO3 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (E,2R)-6-(4-fluorophenyl)-1-phenylmethoxyhex-5-ene-2,4-diol |
| SMILES | OC(/C=C/c1ccc(F)cc1)C[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C19H21FO3/c20-17-9-6-15(7-10-17)8-11-18(21)12-19(22)14-23-13-16-4-2-1-3-5-16/h1-11,18-19,21-22H,12-14H2/b11-8+/t18?,19-/m1/s1 |
| InChIKey | XMGOHOVTJGMWJN-KHZFEFQQSA-N |
| XLogP | 3.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |