C28H37N3O6S — CID 56946776
2-[(2R,3R,11bS)-9,10-dimethoxy-3-[(Z)-C-methyl-N-[(4-methylphenyl)sulfonylamino]carbonimidoyl]-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]ethyl acetate (PubChem CID 56946776) has the molecular formula C28H37N3O6S and a molecular weight of 543.69 g/mol. Its IUPAC name is 2-[(2R,3R,11bS)-9,10-dimethoxy-3-[(Z)-C-methyl-N-[(4-methylphenyl)sulfonylamino]carbonimidoyl]-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]ethyl acetate.
| Compound Name | 2-[(2R,3R,11bS)-9,10-dimethoxy-3-[(Z)-C-methyl-N-[(4-methylphenyl)sulfonylamino]carbonimidoyl]-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]ethyl acetate |
|---|---|
| PubChem CID | 56946776 |
| Molecular Formula | C28H37N3O6S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | 2-[(2R,3R,11bS)-9,10-dimethoxy-3-[(Z)-C-methyl-N-[(4-methylphenyl)sulfonylamino]carbonimidoyl]-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]ethyl acetate |
| SMILES | COc1cc2c(cc1OC)[C@@H]1C[C@H](CCOC(C)=O)[C@@H](/C(C)=N\NS(=O)(=O)c3ccc(C)cc3)CN1CC2 |
| InChI | InChI=1S/C28H37N3O6S/c1-18-6-8-23(9-7-18)38(33,34)30-29-19(2)25-17-31-12-10-21-15-27(35-4)28(36-5)16-24(21)26(31)14-22(25)11-13-37-20(3)32/h6-9,15-16,22,25-26,30H,10-14,17H2,1-5H3/b29-19-/t22-,25+,26-/m0/s1 |
| InChIKey | ULMOUJFRVVQYJG-RVAKLCRCSA-N |
| XLogP | 3.86 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|