C21H19F3N4O2 — CID 56949291
2'-amino-2,2-difluoro-7-(2-fluoro-3-pyridinyl)-3'-methylspiro[3,4,4a,9a-tetrahydro-1H-xanthene-9,5'-imidazole]-4'-one (PubChem CID 56949291) has the molecular formula C21H19F3N4O2 and a molecular weight of 416.40 g/mol. Its IUPAC name is 2'-amino-2,2-difluoro-7-(2-fluoro-3-pyridinyl)-3'-methylspiro[3,4,4a,9a-tetrahydro-1H-xanthene-9,5'-imidazole]-4'-one.
| Compound Name | 2'-amino-2,2-difluoro-7-(2-fluoro-3-pyridinyl)-3'-methylspiro[3,4,4a,9a-tetrahydro-1H-xanthene-9,5'-imidazole]-4'-one |
|---|---|
| PubChem CID | 56949291 |
| Molecular Formula | C21H19F3N4O2 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2'-amino-2,2-difluoro-7-(2-fluoro-3-pyridinyl)-3'-methylspiro[3,4,4a,9a-tetrahydro-1H-xanthene-9,5'-imidazole]-4'-one |
| SMILES | CN1C(=O)C2(N=C1N)c1cc(-c3cccnc3F)ccc1OC1CCC(F)(F)CC12 |
| InChI | InChI=1S/C21H19F3N4O2/c1-28-18(29)21(27-19(28)25)13-9-11(12-3-2-8-26-17(12)22)4-5-15(13)30-16-6-7-20(23,24)10-14(16)21/h2-5,8-9,14,16H,6-7,10H2,1H3,(H2,25,27) |
| InChIKey | FMPILIYIQGZAGA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|