C17H9BrCl3F4NO3 — CID 56949546
1-(3-bromo-4-fluorophenyl)-4,4,4-trifluoro-3-(nitromethyl)-3-(3,4,5-trichlorophenyl)butan-1-one (PubChem CID 56949546) has the molecular formula C17H9BrCl3F4NO3 and a molecular weight of 537.52 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-4,4,4-trifluoro-3-(nitromethyl)-3-(3,4,5-trichlorophenyl)butan-1-one.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-4,4,4-trifluoro-3-(nitromethyl)-3-(3,4,5-trichlorophenyl)butan-1-one |
|---|---|
| PubChem CID | 56949546 |
| Molecular Formula | C17H9BrCl3F4NO3 |
| Molecular Weight | 537.52 g/mol |
| Exact Mass | 534.88 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-4,4,4-trifluoro-3-(nitromethyl)-3-(3,4,5-trichlorophenyl)butan-1-one |
| SMILES | O=C(CC(C[N+](=O)[O-])(c1cc(Cl)c(Cl)c(Cl)c1)C(F)(F)F)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C17H9BrCl3F4NO3/c18-10-3-8(1-2-13(10)22)14(27)6-16(7-26(28)29,17(23,24)25)9-4-11(19)15(21)12(20)5-9/h1-5H,6-7H2 |
| InChIKey | GQVWKCALQVTOHQ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.52 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|