C9H5Cl3F3NO3 — CID 86682593
1,1,1-trifluoro-3-nitro-2-(3,4,5-trichlorophenyl)propan-2-ol (PubChem CID 86682593) has the molecular formula C9H5Cl3F3NO3 and a molecular weight of 338.50 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-nitro-2-(3,4,5-trichlorophenyl)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-nitro-2-(3,4,5-trichlorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 86682593 |
| Molecular Formula | C9H5Cl3F3NO3 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 336.93 |
| IUPAC Name | 1,1,1-trifluoro-3-nitro-2-(3,4,5-trichlorophenyl)propan-2-ol |
| SMILES | O=[N+]([O-])CC(O)(c1cc(Cl)c(Cl)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C9H5Cl3F3NO3/c10-5-1-4(2-6(11)7(5)12)8(17,3-16(18)19)9(13,14)15/h1-2,17H,3H2 |
| InChIKey | MKSRHUXTYGSXKE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|