C23H26ClN3O2 — CID 56963537
4-[(7-chloroquinolin-4-yl)amino]-2-[[[(2R)-2-hydroxypropyl]amino]methyl]-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 56963537) has the molecular formula C23H26ClN3O2 and a molecular weight of 411.93 g/mol. Its IUPAC name is 4-[(7-chloroquinolin-4-yl)amino]-2-[[[(2R)-2-hydroxypropyl]amino]methyl]-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | 4-[(7-chloroquinolin-4-yl)amino]-2-[[[(2R)-2-hydroxypropyl]amino]methyl]-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 56963537 |
| Molecular Formula | C23H26ClN3O2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 4-[(7-chloroquinolin-4-yl)amino]-2-[[[(2R)-2-hydroxypropyl]amino]methyl]-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | C[C@@H](O)CNCc1cc(Nc2ccnc3cc(Cl)ccc23)c2c(c1O)CCCC2 |
| InChI | InChI=1S/C23H26ClN3O2/c1-14(28)12-25-13-15-10-22(17-4-2-3-5-18(17)23(15)29)27-20-8-9-26-21-11-16(24)6-7-19(20)21/h6-11,14,25,28-29H,2-5,12-13H2,1H3,(H,26,27)/t14-/m1/s1 |
| InChIKey | BKZVHRMIEMXFBS-CQSZACIVSA-N |
| XLogP | 4.69 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|