C23H24ClN3O — CID 56963615
4-[(7-chloroquinolin-4-yl)amino]-2-[(prop-2-enylamino)methyl]-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 56963615) has the molecular formula C23H24ClN3O and a molecular weight of 393.92 g/mol. Its IUPAC name is 4-[(7-chloroquinolin-4-yl)amino]-2-[(prop-2-enylamino)methyl]-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | 4-[(7-chloroquinolin-4-yl)amino]-2-[(prop-2-enylamino)methyl]-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 56963615 |
| Molecular Formula | C23H24ClN3O |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 4-[(7-chloroquinolin-4-yl)amino]-2-[(prop-2-enylamino)methyl]-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | C=CCNCc1cc(Nc2ccnc3cc(Cl)ccc23)c2c(c1O)CCCC2 |
| InChI | InChI=1S/C23H24ClN3O/c1-2-10-25-14-15-12-22(17-5-3-4-6-18(17)23(15)28)27-20-9-11-26-21-13-16(24)7-8-19(20)21/h2,7-9,11-13,25,28H,1,3-6,10,14H2,(H,26,27) |
| InChIKey | HVGFTELYXWOCJS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|