C28H30N2O4S — CID 56969249
(9E)-5-(3,4-dimethoxyphenyl)-9-[(3,4-dimethoxyphenyl)methylidene]-3-methyl-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline (PubChem CID 56969249) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is (9E)-5-(3,4-dimethoxyphenyl)-9-[(3,4-dimethoxyphenyl)methylidene]-3-methyl-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline.
| Compound Name | (9E)-5-(3,4-dimethoxyphenyl)-9-[(3,4-dimethoxyphenyl)methylidene]-3-methyl-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline |
|---|---|
| PubChem CID | 56969249 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (9E)-5-(3,4-dimethoxyphenyl)-9-[(3,4-dimethoxyphenyl)methylidene]-3-methyl-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline |
| SMILES | COc1ccc(/C=C2\CCCC3=C2N=C2SC=C(C)N2C3c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C28H30N2O4S/c1-17-16-35-28-29-26-19(13-18-9-11-22(31-2)24(14-18)33-4)7-6-8-21(26)27(30(17)28)20-10-12-23(32-3)25(15-20)34-5/h9-16,27H,6-8H2,1-5H3/b19-13+ |
| InChIKey | GUEUIIMQLVGAFT-CPNJWEJPSA-N |
| XLogP | 6.56 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |