C13H25NOS — CID 56969752
(R)-N-[(E)-3-cyclohexylprop-2-enyl]-2-methylpropane-2-sulfinamide (PubChem CID 56969752) has the molecular formula C13H25NOS and a molecular weight of 243.42 g/mol. Its IUPAC name is (R)-N-[(E)-3-cyclohexylprop-2-enyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(E)-3-cyclohexylprop-2-enyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 56969752 |
| Molecular Formula | C13H25NOS |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | (R)-N-[(E)-3-cyclohexylprop-2-enyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)NC/C=C/C1CCCCC1 |
| InChI | InChI=1S/C13H25NOS/c1-13(2,3)16(15)14-11-7-10-12-8-5-4-6-9-12/h7,10,12,14H,4-6,8-9,11H2,1-3H3/b10-7+/t16-/m1/s1 |
| InChIKey | JFFMBENENIRXAO-OJXHRBAXSA-N |
| XLogP | 3.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|