C14H27NOS — CID 11196188
(S)-N-[(2S)-1-cyclohexylbut-3-en-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 11196188) has the molecular formula C14H27NOS and a molecular weight of 257.44 g/mol. Its IUPAC name is (S)-N-[(2S)-1-cyclohexylbut-3-en-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(2S)-1-cyclohexylbut-3-en-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 11196188 |
| Molecular Formula | C14H27NOS |
| Molecular Weight | 257.44 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (S)-N-[(2S)-1-cyclohexylbut-3-en-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=C[C@H](CC1CCCCC1)N[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C14H27NOS/c1-5-13(15-17(16)14(2,3)4)11-12-9-7-6-8-10-12/h5,12-13,15H,1,6-11H2,2-4H3/t13-,17+/m1/s1 |
| InChIKey | YQDFOYVAXCZLDA-DYVFJYSZSA-N |
| XLogP | 3.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|