C20H30N2O4 — CID 56971072
methyl 2-[2-[[(2E,4Z)-2-methyldodeca-2,4-dienoyl]amino]prop-2-enoylamino]prop-2-enoate (PubChem CID 56971072) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl 2-[2-[[(2E,4Z)-2-methyldodeca-2,4-dienoyl]amino]prop-2-enoylamino]prop-2-enoate.
| Compound Name | methyl 2-[2-[[(2E,4Z)-2-methyldodeca-2,4-dienoyl]amino]prop-2-enoylamino]prop-2-enoate |
|---|---|
| PubChem CID | 56971072 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | methyl 2-[2-[[(2E,4Z)-2-methyldodeca-2,4-dienoyl]amino]prop-2-enoylamino]prop-2-enoate |
| SMILES | C=C(NC(=O)/C(C)=C/C=C\CCCCCCC)C(=O)NC(=C)C(=O)OC |
| InChI | InChI=1S/C20H30N2O4/c1-6-7-8-9-10-11-12-13-14-15(2)18(23)21-16(3)19(24)22-17(4)20(25)26-5/h12-14H,3-4,6-11H2,1-2,5H3,(H,21,23)(H,22,24)/b13-12-,15-14+ |
| InChIKey | SFKWFBHMEPIEDY-FSALDASDSA-N |
| XLogP | 3.28 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|